C10H22N4O3 — CID 111037070
2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide (PubChem CID 111037070) has the molecular formula C10H22N4O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 111037070 |
| Molecular Formula | C10H22N4O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-[[amino-(1-methoxypropan-2-ylamino)methylidene]amino]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)C/N=C(\N)NC(C)COC |
| InChI | InChI=1S/C10H22N4O3/c1-8(7-17-3)14-10(11)13-6-9(15)12-4-5-16-2/h8H,4-7H2,1-3H3,(H,12,15)(H3,11,13,14) |
| InChIKey | SKCMGSXCXFHKPO-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|