C9H19N3O3 — CID 110930535
methyl 3-[[amino-(2-methoxyethylamino)methylidene]amino]-2-methylpropanoate (PubChem CID 110930535) has the molecular formula C9H19N3O3 and a molecular weight of 217.27 g/mol. Its IUPAC name is methyl 3-[[amino-(2-methoxyethylamino)methylidene]amino]-2-methylpropanoate.
| Compound Name | methyl 3-[[amino-(2-methoxyethylamino)methylidene]amino]-2-methylpropanoate |
|---|---|
| PubChem CID | 110930535 |
| Molecular Formula | C9H19N3O3 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.14 |
| IUPAC Name | methyl 3-[[amino-(2-methoxyethylamino)methylidene]amino]-2-methylpropanoate |
| SMILES | COCCN/C(N)=N/CC(C)C(=O)OC |
| InChI | InChI=1S/C9H19N3O3/c1-7(8(13)15-3)6-12-9(10)11-4-5-14-2/h7H,4-6H2,1-3H3,(H3,10,11,12) |
| InChIKey | HEODTZBNKYQYIT-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|