C11H24N4O3 — CID 73080289
propan-2-yl 2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate (PubChem CID 73080289) has the molecular formula C11H24N4O3 and a molecular weight of 260.34 g/mol. Its IUPAC name is propan-2-yl 2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate.
| Compound Name | propan-2-yl 2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate |
|---|---|
| PubChem CID | 73080289 |
| Molecular Formula | C11H24N4O3 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | propan-2-yl 2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate |
| SMILES | COCCN/C(N)=N/CCC(N)C(=O)OC(C)C |
| InChI | InChI=1S/C11H24N4O3/c1-8(2)18-10(16)9(12)4-5-14-11(13)15-6-7-17-3/h8-9H,4-7,12H2,1-3H3,(H3,13,14,15) |
| InChIKey | VCFBGLVSIRJZEY-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|