C16H26N4O4 — CID 66999238
(2-methoxyphenyl)methyl (2S)-2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate (PubChem CID 66999238) has the molecular formula C16H26N4O4 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2-methoxyphenyl)methyl (2S)-2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate.
| Compound Name | (2-methoxyphenyl)methyl (2S)-2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate |
|---|---|
| PubChem CID | 66999238 |
| Molecular Formula | C16H26N4O4 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | (2-methoxyphenyl)methyl (2S)-2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate |
| SMILES | COCCN/C(N)=N/CC[C@H](N)C(=O)OCc1ccccc1OC |
| InChI | InChI=1S/C16H26N4O4/c1-22-10-9-20-16(18)19-8-7-13(17)15(21)24-11-12-5-3-4-6-14(12)23-2/h3-6,13H,7-11,17H2,1-2H3,(H3,18,19,20)/t13-/m0/s1 |
| InChIKey | MHFMXIJKVCRRTL-ZDUSSCGKSA-N |
| XLogP | 0.01 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|