C13H22IN3O3 — CID 75419036
2-[(2,3-dimethoxyphenyl)methyl]-1-(2-methoxyethyl)guanidine;hydroiodide (PubChem CID 75419036) has the molecular formula C13H22IN3O3 and a molecular weight of 395.24 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methyl]-1-(2-methoxyethyl)guanidine;hydroiodide.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 75419036 |
| Molecular Formula | C13H22IN3O3 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 395.07 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
| SMILES | COCCN/C(N)=N/Cc1cccc(OC)c1OC.I |
| InChI | InChI=1S/C13H21N3O3.HI/c1-17-8-7-15-13(14)16-9-10-5-4-6-11(18-2)12(10)19-3;/h4-6H,7-9H2,1-3H3,(H3,14,15,16);1H |
| InChIKey | JXWBPRSPEPOSRW-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|