C14H24IN3O2 — CID 110914959
2-[[2-(ethoxymethyl)phenyl]methyl]-1-(2-methoxyethyl)guanidine;hydroiodide (PubChem CID 110914959) has the molecular formula C14H24IN3O2 and a molecular weight of 393.27 g/mol. Its IUPAC name is 2-[[2-(ethoxymethyl)phenyl]methyl]-1-(2-methoxyethyl)guanidine;hydroiodide.
| Compound Name | 2-[[2-(ethoxymethyl)phenyl]methyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110914959 |
| Molecular Formula | C14H24IN3O2 |
| Molecular Weight | 393.27 g/mol |
| Exact Mass | 393.09 |
| IUPAC Name | 2-[[2-(ethoxymethyl)phenyl]methyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
| SMILES | CCOCc1ccccc1C/N=C(\N)NCCOC.I |
| InChI | InChI=1S/C14H23N3O2.HI/c1-3-19-11-13-7-5-4-6-12(13)10-17-14(15)16-8-9-18-2;/h4-7H,3,8-11H2,1-2H3,(H3,15,16,17);1H |
| InChIKey | ANTFTQDHHJMTFQ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|