C14H24N4O2 — CID 110918831
2-[(2-butoxy-3-pyridinyl)methyl]-1-(2-methoxyethyl)guanidine (PubChem CID 110918831) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 2-[(2-butoxy-3-pyridinyl)methyl]-1-(2-methoxyethyl)guanidine.
| Compound Name | 2-[(2-butoxy-3-pyridinyl)methyl]-1-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 110918831 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 2-[(2-butoxy-3-pyridinyl)methyl]-1-(2-methoxyethyl)guanidine |
| SMILES | CCCCOc1ncccc1C/N=C(\N)NCCOC |
| InChI | InChI=1S/C14H24N4O2/c1-3-4-9-20-13-12(6-5-7-16-13)11-18-14(15)17-8-10-19-2/h5-7H,3-4,8-11H2,1-2H3,(H3,15,17,18) |
| InChIKey | UVZKWFVJSUDXKP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|