C21H30N4O3 — CID 111083443
2-[(2-butoxy-3-pyridinyl)methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine (PubChem CID 111083443) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-[(2-butoxy-3-pyridinyl)methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine.
| Compound Name | 2-[(2-butoxy-3-pyridinyl)methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine |
|---|---|
| PubChem CID | 111083443 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 2-[(2-butoxy-3-pyridinyl)methyl]-1-[2-(3,4-dimethoxyphenyl)ethyl]guanidine |
| SMILES | CCCCOc1ncccc1C/N=C(\N)NCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C21H30N4O3/c1-4-5-13-28-20-17(7-6-11-23-20)15-25-21(22)24-12-10-16-8-9-18(26-2)19(14-16)27-3/h6-9,11,14H,4-5,10,12-13,15H2,1-3H3,(H3,22,24,25) |
| InChIKey | YXIFBYLXXZDUAL-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|