C13H21N3O — CID 55063954
2-[[2-(ethoxymethyl)phenyl]methyl]-1-ethylguanidine (PubChem CID 55063954) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-[[2-(ethoxymethyl)phenyl]methyl]-1-ethylguanidine.
| Compound Name | 2-[[2-(ethoxymethyl)phenyl]methyl]-1-ethylguanidine |
|---|---|
| PubChem CID | 55063954 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-[[2-(ethoxymethyl)phenyl]methyl]-1-ethylguanidine |
| SMILES | CCN/C(N)=N/Cc1ccccc1COCC |
| InChI | InChI=1S/C13H21N3O/c1-3-15-13(14)16-9-11-7-5-6-8-12(11)10-17-4-2/h5-8H,3-4,9-10H2,1-2H3,(H3,14,15,16) |
| InChIKey | KIGATRKEIMRKQH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|