C19H20IN3O — CID 111046321
1-(2-methoxyphenyl)-2-(naphthalen-1-ylmethyl)guanidine;hydroiodide (PubChem CID 111046321) has the molecular formula C19H20IN3O and a molecular weight of 433.29 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-(naphthalen-1-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-(2-methoxyphenyl)-2-(naphthalen-1-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111046321 |
| Molecular Formula | C19H20IN3O |
| Molecular Weight | 433.29 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-(naphthalen-1-ylmethyl)guanidine;hydroiodide |
| SMILES | COc1ccccc1N/C(N)=N/Cc1cccc2ccccc12.I |
| InChI | InChI=1S/C19H19N3O.HI/c1-23-18-12-5-4-11-17(18)22-19(20)21-13-15-9-6-8-14-7-2-3-10-16(14)15;/h2-12H,13H2,1H3,(H3,20,21,22);1H |
| InChIKey | SSOHOTWZGJLXQS-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|