C23H27IN4O3 — CID 111059510
1-(2-methoxyphenyl)-2-[[2-(2-propoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide (PubChem CID 111059510) has the molecular formula C23H27IN4O3 and a molecular weight of 534.40 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-[[2-(2-propoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-methoxyphenyl)-2-[[2-(2-propoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111059510 |
| Molecular Formula | C23H27IN4O3 |
| Molecular Weight | 534.40 g/mol |
| Exact Mass | 534.11 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-[[2-(2-propoxyphenoxy)-3-pyridinyl]methyl]guanidine;hydroiodide |
| SMILES | CCCOc1ccccc1Oc1ncccc1C/N=C(\N)Nc1ccccc1OC.I |
| InChI | InChI=1S/C23H26N4O3.HI/c1-3-15-29-20-12-6-7-13-21(20)30-22-17(9-8-14-25-22)16-26-23(24)27-18-10-4-5-11-19(18)28-2;/h4-14H,3,15-16H2,1-2H3,(H3,24,26,27);1H |
| InChIKey | WJTLOYCROLERLB-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.40 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|