C18H23N3O2 — CID 111045820
2-[(2,3-dimethoxyphenyl)methyl]-1-(3,4-dimethylphenyl)guanidine (PubChem CID 111045820) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 2-[(2,3-dimethoxyphenyl)methyl]-1-(3,4-dimethylphenyl)guanidine.
| Compound Name | 2-[(2,3-dimethoxyphenyl)methyl]-1-(3,4-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 111045820 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-[(2,3-dimethoxyphenyl)methyl]-1-(3,4-dimethylphenyl)guanidine |
| SMILES | COc1cccc(C/N=C(\N)Nc2ccc(C)c(C)c2)c1OC |
| InChI | InChI=1S/C18H23N3O2/c1-12-8-9-15(10-13(12)2)21-18(19)20-11-14-6-5-7-16(22-3)17(14)23-4/h5-10H,11H2,1-4H3,(H3,19,20,21) |
| InChIKey | HAEMGRXPXWHQBX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|