C16H18BrN3O2 — CID 111045422
2-[(2-bromophenyl)methyl]-1-(3,4-dimethoxyphenyl)guanidine (PubChem CID 111045422) has the molecular formula C16H18BrN3O2 and a molecular weight of 364.24 g/mol. Its IUPAC name is 2-[(2-bromophenyl)methyl]-1-(3,4-dimethoxyphenyl)guanidine.
| Compound Name | 2-[(2-bromophenyl)methyl]-1-(3,4-dimethoxyphenyl)guanidine |
|---|---|
| PubChem CID | 111045422 |
| Molecular Formula | C16H18BrN3O2 |
| Molecular Weight | 364.24 g/mol |
| Exact Mass | 363.06 |
| IUPAC Name | 2-[(2-bromophenyl)methyl]-1-(3,4-dimethoxyphenyl)guanidine |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccccc2Br)cc1OC |
| InChI | InChI=1S/C16H18BrN3O2/c1-21-14-8-7-12(9-15(14)22-2)20-16(18)19-10-11-5-3-4-6-13(11)17/h3-9H,10H2,1-2H3,(H3,18,19,20) |
| InChIKey | ATAQNOHABNHPSG-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|