C18H22BrN3O2 — CID 111098917
2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(3,5-dimethylphenyl)guanidine (PubChem CID 111098917) has the molecular formula C18H22BrN3O2 and a molecular weight of 392.30 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(3,5-dimethylphenyl)guanidine.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(3,5-dimethylphenyl)guanidine |
|---|---|
| PubChem CID | 111098917 |
| Molecular Formula | C18H22BrN3O2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-(3,5-dimethylphenyl)guanidine |
| SMILES | COc1cc(Br)c(C/N=C(\N)Nc2cc(C)cc(C)c2)cc1OC |
| InChI | InChI=1S/C18H22BrN3O2/c1-11-5-12(2)7-14(6-11)22-18(20)21-10-13-8-16(23-3)17(24-4)9-15(13)19/h5-9H,10H2,1-4H3,(H3,20,21,22) |
| InChIKey | TZBYWCJCSLPYMQ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|