C23H25N3O4 — CID 111808554
1-(3,4-dimethoxyphenyl)-2-[[4-(2-methoxyphenoxy)phenyl]methyl]guanidine (PubChem CID 111808554) has the molecular formula C23H25N3O4 and a molecular weight of 407.47 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[[4-(2-methoxyphenoxy)phenyl]methyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[[4-(2-methoxyphenoxy)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111808554 |
| Molecular Formula | C23H25N3O4 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.18 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[[4-(2-methoxyphenoxy)phenyl]methyl]guanidine |
| SMILES | COc1ccc(N/C(N)=N/Cc2ccc(Oc3ccccc3OC)cc2)cc1OC |
| InChI | InChI=1S/C23H25N3O4/c1-27-19-6-4-5-7-21(19)30-18-11-8-16(9-12-18)15-25-23(24)26-17-10-13-20(28-2)22(14-17)29-3/h4-14H,15H2,1-3H3,(H3,24,25,26) |
| InChIKey | JOTUPEHBDCROBP-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|