C17H22N4O4S — CID 111046426
1-(3,4-dimethoxyphenyl)-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine (PubChem CID 111046426) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111046426 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-2-[[4-(methylsulfamoyl)phenyl]methyl]guanidine |
| SMILES | CNS(=O)(=O)c1ccc(C/N=C(\N)Nc2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C17H22N4O4S/c1-19-26(22,23)14-7-4-12(5-8-14)11-20-17(18)21-13-6-9-15(24-2)16(10-13)25-3/h4-10,19H,11H2,1-3H3,(H3,18,20,21) |
| InChIKey | GEGRPOQBOQHWRP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|