C12H26N4O3 — CID 72796651
butyl 2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate (PubChem CID 72796651) has the molecular formula C12H26N4O3 and a molecular weight of 274.36 g/mol. Its IUPAC name is butyl 2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate.
| Compound Name | butyl 2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate |
|---|---|
| PubChem CID | 72796651 |
| Molecular Formula | C12H26N4O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.20 |
| IUPAC Name | butyl 2-amino-4-[[amino-(2-methoxyethylamino)methylidene]amino]butanoate |
| SMILES | CCCCOC(=O)C(N)CC/N=C(\N)NCCOC |
| InChI | InChI=1S/C12H26N4O3/c1-3-4-8-19-11(17)10(13)5-6-15-12(14)16-7-9-18-2/h10H,3-9,13H2,1-2H3,(H3,14,15,16) |
| InChIKey | GBJNKKZERCARKH-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 111.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|