C10H23N5O4S — CID 122382582
(2S)-2-amino-5-[[amino-(2-methoxyethylamino)methylidene]amino]-N-methylsulfonylpentanamide (PubChem CID 122382582) has the molecular formula C10H23N5O4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (2S)-2-amino-5-[[amino-(2-methoxyethylamino)methylidene]amino]-N-methylsulfonylpentanamide.
| Compound Name | (2S)-2-amino-5-[[amino-(2-methoxyethylamino)methylidene]amino]-N-methylsulfonylpentanamide |
|---|---|
| PubChem CID | 122382582 |
| Molecular Formula | C10H23N5O4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | (2S)-2-amino-5-[[amino-(2-methoxyethylamino)methylidene]amino]-N-methylsulfonylpentanamide |
| SMILES | COCCN/C(N)=N/CCC[C@H](N)C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C10H23N5O4S/c1-19-7-6-14-10(12)13-5-3-4-8(11)9(16)15-20(2,17)18/h8H,3-7,11H2,1-2H3,(H,15,16)(H3,12,13,14)/t8-/m0/s1 |
| InChIKey | HXDQLJWDFPZZSF-QMMMGPOBSA-N |
| XLogP | -2.28 |
| TPSA | 148.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|