C10H25IN4O3S — CID 110917859
2-[3-[ethyl(methylsulfonyl)amino]propyl]-1-(2-methoxyethyl)guanidine;hydroiodide (PubChem CID 110917859) has the molecular formula C10H25IN4O3S and a molecular weight of 408.31 g/mol. Its IUPAC name is 2-[3-[ethyl(methylsulfonyl)amino]propyl]-1-(2-methoxyethyl)guanidine;hydroiodide.
| Compound Name | 2-[3-[ethyl(methylsulfonyl)amino]propyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110917859 |
| Molecular Formula | C10H25IN4O3S |
| Molecular Weight | 408.31 g/mol |
| Exact Mass | 408.07 |
| IUPAC Name | 2-[3-[ethyl(methylsulfonyl)amino]propyl]-1-(2-methoxyethyl)guanidine;hydroiodide |
| SMILES | CCN(CCC/N=C(\N)NCCOC)S(C)(=O)=O.I |
| InChI | InChI=1S/C10H24N4O3S.HI/c1-4-14(18(3,15)16)8-5-6-12-10(11)13-7-9-17-2;/h4-9H2,1-3H3,(H3,11,12,13);1H |
| InChIKey | IMCULPIUOABVRD-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.31 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|