C10H22N4O2S — CID 136700148
2-[3-[ethyl(methylsulfonyl)amino]propyl]-1-prop-2-enylguanidine (PubChem CID 136700148) has the molecular formula C10H22N4O2S and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-[3-[ethyl(methylsulfonyl)amino]propyl]-1-prop-2-enylguanidine.
| Compound Name | 2-[3-[ethyl(methylsulfonyl)amino]propyl]-1-prop-2-enylguanidine |
|---|---|
| PubChem CID | 136700148 |
| Molecular Formula | C10H22N4O2S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 2-[3-[ethyl(methylsulfonyl)amino]propyl]-1-prop-2-enylguanidine |
| SMILES | C=CCN/C(N)=N/CCCN(CC)S(C)(=O)=O |
| InChI | InChI=1S/C10H22N4O2S/c1-4-7-12-10(11)13-8-6-9-14(5-2)17(3,15)16/h4H,1,5-9H2,2-3H3,(H3,11,12,13) |
| InChIKey | FSZXNQGXAXWZFE-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|