C13H30N4O2S — CID 110967286
1-tert-butyl-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine (PubChem CID 110967286) has the molecular formula C13H30N4O2S and a molecular weight of 306.48 g/mol. Its IUPAC name is 1-tert-butyl-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine.
| Compound Name | 1-tert-butyl-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 110967286 |
| Molecular Formula | C13H30N4O2S |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-tert-butyl-3-ethyl-2-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine |
| SMILES | CCN/C(=N\CCCN(CC)S(C)(=O)=O)NC(C)(C)C |
| InChI | InChI=1S/C13H30N4O2S/c1-7-14-12(16-13(3,4)5)15-10-9-11-17(8-2)20(6,18)19/h7-11H2,1-6H3,(H2,14,15,16) |
| InChIKey | GYGOTZUKYDZCFW-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|