C12H29IN4 — CID 110965066
1-tert-butyl-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]guanidine;hydroiodide (PubChem CID 110965066) has the molecular formula C12H29IN4 and a molecular weight of 356.30 g/mol. Its IUPAC name is 1-tert-butyl-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110965066 |
| Molecular Formula | C12H29IN4 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 1-tert-butyl-3-ethyl-2-[2-[ethyl(methyl)amino]ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN(C)CC)NC(C)(C)C.I |
| InChI | InChI=1S/C12H28N4.HI/c1-7-13-11(15-12(3,4)5)14-9-10-16(6)8-2;/h7-10H2,1-6H3,(H2,13,14,15);1H |
| InChIKey | CTBVVGVNQCFQHM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|