C9H23IN4O2S — CID 110967375
1-tert-butyl-3-ethyl-2-(2-sulfamoylethyl)guanidine;hydroiodide (PubChem CID 110967375) has the molecular formula C9H23IN4O2S and a molecular weight of 378.28 g/mol. Its IUPAC name is 1-tert-butyl-3-ethyl-2-(2-sulfamoylethyl)guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-3-ethyl-2-(2-sulfamoylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110967375 |
| Molecular Formula | C9H23IN4O2S |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 1-tert-butyl-3-ethyl-2-(2-sulfamoylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCS(N)(=O)=O)NC(C)(C)C.I |
| InChI | InChI=1S/C9H22N4O2S.HI/c1-5-11-8(13-9(2,3)4)12-6-7-16(10,14)15;/h5-7H2,1-4H3,(H2,10,14,15)(H2,11,12,13);1H |
| InChIKey | BFNPQRJGESILFO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|