C11H21IN4O2S2 — CID 111351289
1-ethyl-2-(2-sulfamoylethyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111351289) has the molecular formula C11H21IN4O2S2 and a molecular weight of 432.35 g/mol. Its IUPAC name is 1-ethyl-2-(2-sulfamoylethyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(2-sulfamoylethyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111351289 |
| Molecular Formula | C11H21IN4O2S2 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 1-ethyl-2-(2-sulfamoylethyl)-3-(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCS(N)(=O)=O)NCCc1cccs1.I |
| InChI | InChI=1S/C11H20N4O2S2.HI/c1-2-13-11(15-7-9-19(12,16)17)14-6-5-10-4-3-8-18-10;/h3-4,8H,2,5-7,9H2,1H3,(H2,12,16,17)(H2,13,14,15);1H |
| InChIKey | QNKMYCOBXSPGOW-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 96.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|