C15H22IN3S2 — CID 111350617
1-ethyl-2,3-bis(2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111350617) has the molecular formula C15H22IN3S2 and a molecular weight of 435.40 g/mol. Its IUPAC name is 1-ethyl-2,3-bis(2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2,3-bis(2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111350617 |
| Molecular Formula | C15H22IN3S2 |
| Molecular Weight | 435.40 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 1-ethyl-2,3-bis(2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCc1cccs1)NCCc1cccs1.I |
| InChI | InChI=1S/C15H21N3S2.HI/c1-2-16-15(17-9-7-13-5-3-11-19-13)18-10-8-14-6-4-12-20-14;/h3-6,11-12H,2,7-10H2,1H3,(H2,16,17,18);1H |
| InChIKey | HXCMCTJRZDZVKS-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|