C9H23IN4O3S — CID 110976812
1-ethyl-2-(3-methoxypropyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide (PubChem CID 110976812) has the molecular formula C9H23IN4O3S and a molecular weight of 394.28 g/mol. Its IUPAC name is 1-ethyl-2-(3-methoxypropyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-(3-methoxypropyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110976812 |
| Molecular Formula | C9H23IN4O3S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | 1-ethyl-2-(3-methoxypropyl)-3-(2-sulfamoylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC)NCCS(N)(=O)=O.I |
| InChI | InChI=1S/C9H22N4O3S.HI/c1-3-11-9(12-5-4-7-16-2)13-6-8-17(10,14)15;/h3-8H2,1-2H3,(H2,10,14,15)(H2,11,12,13);1H |
| InChIKey | DYBQZJJBXDVSKY-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 105.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|