C11H27IN4O3S — CID 110974594
1-ethyl-3-[3-(methanesulfonamido)propyl]-2-(3-methoxypropyl)guanidine;hydroiodide (PubChem CID 110974594) has the molecular formula C11H27IN4O3S and a molecular weight of 422.33 g/mol. Its IUPAC name is 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-(3-methoxypropyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-(3-methoxypropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110974594 |
| Molecular Formula | C11H27IN4O3S |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 422.08 |
| IUPAC Name | 1-ethyl-3-[3-(methanesulfonamido)propyl]-2-(3-methoxypropyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOC)NCCCNS(C)(=O)=O.I |
| InChI | InChI=1S/C11H26N4O3S.HI/c1-4-12-11(14-8-6-10-18-2)13-7-5-9-15-19(3,16)17;/h15H,4-10H2,1-3H3,(H2,12,13,14);1H |
| InChIKey | LWIFIHBIKJSSOX-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|