C10H24N4O2S2 — CID 111343741
1-ethyl-2-[3-(methanesulfonamido)propyl]-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111343741) has the molecular formula C10H24N4O2S2 and a molecular weight of 296.46 g/mol. Its IUPAC name is 1-ethyl-2-[3-(methanesulfonamido)propyl]-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 1-ethyl-2-[3-(methanesulfonamido)propyl]-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111343741 |
| Molecular Formula | C10H24N4O2S2 |
| Molecular Weight | 296.46 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | 1-ethyl-2-[3-(methanesulfonamido)propyl]-3-(2-methylsulfanylethyl)guanidine |
| SMILES | CCN/C(=N\CCCNS(C)(=O)=O)NCCSC |
| InChI | InChI=1S/C10H24N4O2S2/c1-4-11-10(13-8-9-17-2)12-6-5-7-14-18(3,15)16/h14H,4-9H2,1-3H3,(H2,11,12,13) |
| InChIKey | WAHNQZDXYOKADZ-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.46 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|