C13H29N3S — CID 111637938
2-(4,4-dimethylpentyl)-1-ethyl-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111637938) has the molecular formula C13H29N3S and a molecular weight of 259.46 g/mol. Its IUPAC name is 2-(4,4-dimethylpentyl)-1-ethyl-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 2-(4,4-dimethylpentyl)-1-ethyl-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111637938 |
| Molecular Formula | C13H29N3S |
| Molecular Weight | 259.46 g/mol |
| Exact Mass | 259.21 |
| IUPAC Name | 2-(4,4-dimethylpentyl)-1-ethyl-3-(2-methylsulfanylethyl)guanidine |
| SMILES | CCN/C(=N\CCCC(C)(C)C)NCCSC |
| InChI | InChI=1S/C13H29N3S/c1-6-14-12(16-10-11-17-5)15-9-7-8-13(2,3)4/h6-11H2,1-5H3,(H2,14,15,16) |
| InChIKey | ACONYLGNWOYSBH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|