C14H31N3O — CID 111637964
1-(4,4-dimethylpentyl)-3-ethyl-2-(3-methoxypropyl)guanidine (PubChem CID 111637964) has the molecular formula C14H31N3O and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-(4,4-dimethylpentyl)-3-ethyl-2-(3-methoxypropyl)guanidine.
| Compound Name | 1-(4,4-dimethylpentyl)-3-ethyl-2-(3-methoxypropyl)guanidine |
|---|---|
| PubChem CID | 111637964 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | 1-(4,4-dimethylpentyl)-3-ethyl-2-(3-methoxypropyl)guanidine |
| SMILES | CCN/C(=N\CCCOC)NCCCC(C)(C)C |
| InChI | InChI=1S/C14H31N3O/c1-6-15-13(17-11-8-12-18-5)16-10-7-9-14(2,3)4/h6-12H2,1-5H3,(H2,15,16,17) |
| InChIKey | VADOPTZPGKULIM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|