C12H27N3OS — CID 111344091
2-(4-ethoxybutyl)-1-ethyl-3-(2-methylsulfanylethyl)guanidine (PubChem CID 111344091) has the molecular formula C12H27N3OS and a molecular weight of 261.43 g/mol. Its IUPAC name is 2-(4-ethoxybutyl)-1-ethyl-3-(2-methylsulfanylethyl)guanidine.
| Compound Name | 2-(4-ethoxybutyl)-1-ethyl-3-(2-methylsulfanylethyl)guanidine |
|---|---|
| PubChem CID | 111344091 |
| Molecular Formula | C12H27N3OS |
| Molecular Weight | 261.43 g/mol |
| Exact Mass | 261.19 |
| IUPAC Name | 2-(4-ethoxybutyl)-1-ethyl-3-(2-methylsulfanylethyl)guanidine |
| SMILES | CCN/C(=N\CCCCOCC)NCCSC |
| InChI | InChI=1S/C12H27N3OS/c1-4-13-12(15-9-11-17-3)14-8-6-7-10-16-5-2/h4-11H2,1-3H3,(H2,13,14,15) |
| InChIKey | YRKSCFIJFCGCEE-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.43 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|