C11H26IN3O2S — CID 111344152
1-ethyl-2-[2-(2-methoxyethoxy)ethyl]-3-(2-methylsulfanylethyl)guanidine;hydroiodide (PubChem CID 111344152) has the molecular formula C11H26IN3O2S and a molecular weight of 391.32 g/mol. Its IUPAC name is 1-ethyl-2-[2-(2-methoxyethoxy)ethyl]-3-(2-methylsulfanylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[2-(2-methoxyethoxy)ethyl]-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111344152 |
| Molecular Formula | C11H26IN3O2S |
| Molecular Weight | 391.32 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 1-ethyl-2-[2-(2-methoxyethoxy)ethyl]-3-(2-methylsulfanylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCOCCOC)NCCSC.I |
| InChI | InChI=1S/C11H25N3O2S.HI/c1-4-12-11(14-6-10-17-3)13-5-7-16-9-8-15-2;/h4-10H2,1-3H3,(H2,12,13,14);1H |
| InChIKey | BAVBMWKVUIGWTI-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.32 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|