C16H28N4O4S — CID 111076263
2-[(3,4-dimethoxyphenyl)methyl]-1-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine (PubChem CID 111076263) has the molecular formula C16H28N4O4S and a molecular weight of 372.49 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 111076263 |
| Molecular Formula | C16H28N4O4S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[3-[ethyl(methylsulfonyl)amino]propyl]guanidine |
| SMILES | CCN(CCCN/C(N)=N/Cc1ccc(OC)c(OC)c1)S(C)(=O)=O |
| InChI | InChI=1S/C16H28N4O4S/c1-5-20(25(4,21)22)10-6-9-18-16(17)19-12-13-7-8-14(23-2)15(11-13)24-3/h7-8,11H,5-6,9-10,12H2,1-4H3,(H3,17,18,19) |
| InChIKey | SSTBAXRENWFCNN-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|