C15H26N4O4S — CID 111093519
2-[(3,4-dimethoxyphenyl)methyl]-1-[3-(ethylsulfonylamino)propyl]guanidine (PubChem CID 111093519) has the molecular formula C15H26N4O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-[3-(ethylsulfonylamino)propyl]guanidine.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[3-(ethylsulfonylamino)propyl]guanidine |
|---|---|
| PubChem CID | 111093519 |
| Molecular Formula | C15H26N4O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-[3-(ethylsulfonylamino)propyl]guanidine |
| SMILES | CCS(=O)(=O)NCCCN/C(N)=N/Cc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C15H26N4O4S/c1-4-24(20,21)19-9-5-8-17-15(16)18-11-12-6-7-13(22-2)14(10-12)23-3/h6-7,10,19H,4-5,8-9,11H2,1-3H3,(H3,16,17,18) |
| InChIKey | HPDMHTWRLJXAAA-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|