C12H21IN4O4S — CID 111046622
2-[(3,4-dimethoxyphenyl)methyl]-1-(2-sulfamoylethyl)guanidine;hydroiodide (PubChem CID 111046622) has the molecular formula C12H21IN4O4S and a molecular weight of 444.30 g/mol. Its IUPAC name is 2-[(3,4-dimethoxyphenyl)methyl]-1-(2-sulfamoylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-(2-sulfamoylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111046622 |
| Molecular Formula | C12H21IN4O4S |
| Molecular Weight | 444.30 g/mol |
| Exact Mass | 444.03 |
| IUPAC Name | 2-[(3,4-dimethoxyphenyl)methyl]-1-(2-sulfamoylethyl)guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCCS(N)(=O)=O)cc1OC.I |
| InChI | InChI=1S/C12H20N4O4S.HI/c1-19-10-4-3-9(7-11(10)20-2)8-16-12(13)15-5-6-21(14,17)18;/h3-4,7H,5-6,8H2,1-2H3,(H3,13,15,16)(H2,14,17,18);1H |
| InChIKey | KDSKHICVFMEIDU-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.30 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|