C19H26IN3O4S — CID 111085352
1-[3-(benzenesulfonyl)propyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine;hydroiodide (PubChem CID 111085352) has the molecular formula C19H26IN3O4S and a molecular weight of 519.41 g/mol. Its IUPAC name is 1-[3-(benzenesulfonyl)propyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[3-(benzenesulfonyl)propyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111085352 |
| Molecular Formula | C19H26IN3O4S |
| Molecular Weight | 519.41 g/mol |
| Exact Mass | 519.07 |
| IUPAC Name | 1-[3-(benzenesulfonyl)propyl]-2-[(3,4-dimethoxyphenyl)methyl]guanidine;hydroiodide |
| SMILES | COc1ccc(C/N=C(\N)NCCCS(=O)(=O)c2ccccc2)cc1OC.I |
| InChI | InChI=1S/C19H25N3O4S.HI/c1-25-17-10-9-15(13-18(17)26-2)14-22-19(20)21-11-6-12-27(23,24)16-7-4-3-5-8-16;/h3-5,7-10,13H,6,11-12,14H2,1-2H3,(H3,20,21,22);1H |
| InChIKey | AKWJUKMTFFDYRH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|