C10H22N4O3 — CID 72815086
2-amino-4-[[amino-(2-propan-2-yloxyethylamino)methylidene]amino]butanoic acid (PubChem CID 72815086) has the molecular formula C10H22N4O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is 2-amino-4-[[amino-(2-propan-2-yloxyethylamino)methylidene]amino]butanoic acid.
| Compound Name | 2-amino-4-[[amino-(2-propan-2-yloxyethylamino)methylidene]amino]butanoic acid |
|---|---|
| PubChem CID | 72815086 |
| Molecular Formula | C10H22N4O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 2-amino-4-[[amino-(2-propan-2-yloxyethylamino)methylidene]amino]butanoic acid |
| SMILES | CC(C)OCCN/C(N)=N/CCC(N)C(=O)O |
| InChI | InChI=1S/C10H22N4O3/c1-7(2)17-6-5-14-10(12)13-4-3-8(11)9(15)16/h7-8H,3-6,11H2,1-2H3,(H,15,16)(H3,12,13,14) |
| InChIKey | JEJNUEMFGJGVEA-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 122.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|