C6H14N2O2 — CID 22179539
2-propan-2-yloxyethylurea (PubChem CID 22179539) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-propan-2-yloxyethylurea.
| Compound Name | 2-propan-2-yloxyethylurea |
|---|---|
| PubChem CID | 22179539 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 2-propan-2-yloxyethylurea |
| SMILES | CC(C)OCCNC(N)=O |
| InChI | InChI=1S/C6H14N2O2/c1-5(2)10-4-3-8-6(7)9/h5H,3-4H2,1-2H3,(H3,7,8,9) |
| InChIKey | BEWVZKCMEMXARG-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|