C12H24N2O7 — CID 173187285
3-[2-[2-[1-[2-(carbamoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (PubChem CID 173187285) has the molecular formula C12H24N2O7 and a molecular weight of 308.33 g/mol. Its IUPAC name is 3-[2-[2-[1-[2-(carbamoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-[1-[2-(carbamoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 173187285 |
| Molecular Formula | C12H24N2O7 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | 3-[2-[2-[1-[2-(carbamoylamino)ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| SMILES | CC(OCCNC(N)=O)OCCOCCOCCC(=O)O |
| InChI | InChI=1S/C12H24N2O7/c1-10(20-5-3-14-12(13)17)21-9-8-19-7-6-18-4-2-11(15)16/h10H,2-9H2,1H3,(H,15,16)(H3,13,14,17) |
| InChIKey | CFVNKYLKJDONHD-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|