C10H20O5 — CID 87458033
3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanoic acid (PubChem CID 87458033) has the molecular formula C10H20O5 and a molecular weight of 220.26 g/mol. Its IUPAC name is 3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanoic acid.
| Compound Name | 3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 87458033 |
| Molecular Formula | C10H20O5 |
| Molecular Weight | 220.26 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 3-[2-(2-propan-2-yloxyethoxy)ethoxy]propanoic acid |
| SMILES | CC(C)OCCOCCOCCC(=O)O |
| InChI | InChI=1S/C10H20O5/c1-9(2)15-8-7-14-6-5-13-4-3-10(11)12/h9H,3-8H2,1-2H3,(H,11,12) |
| InChIKey | PUVSSOVPOIWENC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|