C11H22O5 — CID 87457805
3-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]propanoic acid (PubChem CID 87457805) has the molecular formula C11H22O5 and a molecular weight of 234.29 g/mol. Its IUPAC name is 3-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]propanoic acid.
| Compound Name | 3-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 87457805 |
| Molecular Formula | C11H22O5 |
| Molecular Weight | 234.29 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | 3-[2-[2-(2-methylpropoxy)ethoxy]ethoxy]propanoic acid |
| SMILES | CC(C)COCCOCCOCCC(=O)O |
| InChI | InChI=1S/C11H22O5/c1-10(2)9-16-8-7-15-6-5-14-4-3-11(12)13/h10H,3-9H2,1-2H3,(H,12,13) |
| InChIKey | ZVGGHXFROKXQNT-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.29 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|