C7H15NO4 — CID 140704240
3-[1-(2-aminoethoxy)ethoxy]propanoic acid (PubChem CID 140704240) has the molecular formula C7H15NO4 and a molecular weight of 177.20 g/mol. Its IUPAC name is 3-[1-(2-aminoethoxy)ethoxy]propanoic acid.
| Compound Name | 3-[1-(2-aminoethoxy)ethoxy]propanoic acid |
|---|---|
| PubChem CID | 140704240 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 3-[1-(2-aminoethoxy)ethoxy]propanoic acid |
| SMILES | CC(OCCN)OCCC(=O)O |
| InChI | InChI=1S/C7H15NO4/c1-6(12-5-3-8)11-4-2-7(9)10/h6H,2-5,8H2,1H3,(H,9,10) |
| InChIKey | INRYZCPICXQBHA-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|