3-(2-aminoethoxy)butanoic acid

C6H13NO3 — CID 146218165

IUPAC3-(2-aminoethoxy)butanoic acid
SMILESCC(CC(=O)O)OCCN
InChIInChI=1S/C6H13NO3/c1-5(4-6(8)9)10-3-2-7/h5H,2-4,7H2,1H3,(H,8,9)
InChIKeyWUVCJPMKXOSBIJ-UHFFFAOYSA-N
MW147.17 g/mol
LogP-0.18
Rot. Bonds5

About 3-(2-aminoethoxy)butanoic acid

3-(2-aminoethoxy)butanoic acid (PubChem CID 146218165) has the molecular formula C6H13NO3 and a molecular weight of 147.17 g/mol. Its IUPAC name is 3-(2-aminoethoxy)butanoic acid.

Molecular Properties

Compound Name3-(2-aminoethoxy)butanoic acid
PubChem CID146218165
Molecular FormulaC6H13NO3
Molecular Weight147.17 g/mol
Exact Mass147.09
IUPAC Name3-(2-aminoethoxy)butanoic acid
SMILESCC(CC(=O)O)OCCN
InChIInChI=1S/C6H13NO3/c1-5(4-6(8)9)10-3-2-7/h5H,2-4,7H2,1H3,(H,8,9)
InChIKeyWUVCJPMKXOSBIJ-UHFFFAOYSA-N
XLogP-0.18
TPSA72.55 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500147.17
LogP ≤ 5-0.18
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 3-(2-aminoethoxy)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-[2-(1-carboxypropan-2-yloxy)ethoxy]butanoic acid
CID 139938687
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]butanoic acid
CID 146502180
3-ethoxybutanoic acid
CID 20508399
2-(2-aminoethoxy)propylcarbamic acid
CID 175060404
3-hexoxybutanoic acid
CID 43536148
3-[1-(2-aminoethoxy)ethoxy]propanoic acid
CID 140704240
(3R)-3-(methoxymethoxy)butanoic acid
CID 10487007
3-(2-phenylethoxy)butanoic acid
CID 43536152
(3S)-3-methoxybutanoic acid
CID 51374275
4-(2-aminoethoxy)pentan-2-ol
CID 173098597
3-carbonofluoridoyloxybutanoic acid
CID 130374957
2-[1-[1-[1-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetic acid
CID 175484836

Frequently Asked Questions

What is the IUPAC name of 3-(2-aminoethoxy)butanoic acid?
The IUPAC name of 3-(2-aminoethoxy)butanoic acid (CID 146218165) is 3-(2-aminoethoxy)butanoic acid.
What is the SMILES notation for 3-(2-aminoethoxy)butanoic acid?
The canonical SMILES for 3-(2-aminoethoxy)butanoic acid is CC(CC(=O)O)OCCN.
What is the InChIKey of 3-(2-aminoethoxy)butanoic acid?
The InChIKey is WUVCJPMKXOSBIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3/c1-5(4-6(8)9)10-3-2-7/h5H,2-4,7H2,1H3,(H,8,9).
What are the key properties of 3-(2-aminoethoxy)butanoic acid?
3-(2-aminoethoxy)butanoic acid has a molecular weight of 147.17 g/mol, XLogP of -0.18, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-aminoethoxy)butanoic acid is sourced from PubChem (CID 146218165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).