2-(2-aminoethoxy)propylcarbamic acid

C6H14N2O3 — CID 175060404

IUPAC2-(2-aminoethoxy)propylcarbamic acid
SMILESCC(CNC(=O)O)OCCN
InChIInChI=1S/C6H14N2O3/c1-5(11-3-2-7)4-8-6(9)10/h5,8H,2-4,7H2,1H3,(H,9,10)
InChIKeyLBONZCRHIOLTIT-UHFFFAOYSA-N
MW162.19 g/mol
LogP-0.38
Rot. Bonds5

About 2-(2-aminoethoxy)propylcarbamic acid

2-(2-aminoethoxy)propylcarbamic acid (PubChem CID 175060404) has the molecular formula C6H14N2O3 and a molecular weight of 162.19 g/mol. Its IUPAC name is 2-(2-aminoethoxy)propylcarbamic acid.

Molecular Properties

Compound Name2-(2-aminoethoxy)propylcarbamic acid
PubChem CID175060404
Molecular FormulaC6H14N2O3
Molecular Weight162.19 g/mol
Exact Mass162.10
IUPAC Name2-(2-aminoethoxy)propylcarbamic acid
SMILESCC(CNC(=O)O)OCCN
InChIInChI=1S/C6H14N2O3/c1-5(11-3-2-7)4-8-6(9)10/h5,8H,2-4,7H2,1H3,(H,9,10)
InChIKeyLBONZCRHIOLTIT-UHFFFAOYSA-N
XLogP-0.38
TPSA84.58 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.19
LogP ≤ 5-0.38
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-(2-aminoethoxy)propylcarbamic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(2-hydroxyethoxy)propylcarbamic acid
CID 87536383
3-(2-aminoethoxy)butanoic acid
CID 146218165
2-(2-aminoethoxy)-N-(2-ethoxypropyl)acetamide
CID 115739454
propyl N-[2-(2-hydroxyethoxy)propyl]carbamate
CID 54036136
4-[2-[2-(2-aminoethoxy)-2-methylpropoxy]propylamino]-4-oxobutanoic acid
CID 156733974
2-(2-aminoethoxy)-N-prop-2-ynylpropanamide
CID 62342840
methyl 2-(2-aminoethoxy)propanoate;hydrochloride
CID 175589324
(2-amino-3-propan-2-yloxypropyl)carbamic acid
CID 90113909
2-[2-(1-acetamidopropan-2-yloxy)ethoxy]acetic acid
CID 57218988
4-(2-aminoethoxy)pentan-2-ol
CID 173098597
3-[1-(2-aminoethoxy)ethoxy]propanoic acid
CID 140704240
methyl N-(2-ethoxypropyl)carbamate
CID 115649304

Frequently Asked Questions

What is the IUPAC name of 2-(2-aminoethoxy)propylcarbamic acid?
The IUPAC name of 2-(2-aminoethoxy)propylcarbamic acid (CID 175060404) is 2-(2-aminoethoxy)propylcarbamic acid.
What is the SMILES notation for 2-(2-aminoethoxy)propylcarbamic acid?
The canonical SMILES for 2-(2-aminoethoxy)propylcarbamic acid is CC(CNC(=O)O)OCCN.
What is the InChIKey of 2-(2-aminoethoxy)propylcarbamic acid?
The InChIKey is LBONZCRHIOLTIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O3/c1-5(11-3-2-7)4-8-6(9)10/h5,8H,2-4,7H2,1H3,(H,9,10).
What are the key properties of 2-(2-aminoethoxy)propylcarbamic acid?
2-(2-aminoethoxy)propylcarbamic acid has a molecular weight of 162.19 g/mol, XLogP of -0.38, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethoxy)propylcarbamic acid is sourced from PubChem (CID 175060404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).