C10H21NO6 — CID 175484836
2-[1-[1-[1-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 175484836) has the molecular formula C10H21NO6 and a molecular weight of 251.28 g/mol. Its IUPAC name is 2-[1-[1-[1-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[1-[1-[1-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 175484836 |
| Molecular Formula | C10H21NO6 |
| Molecular Weight | 251.28 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 2-[1-[1-[1-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | CC(OCCN)OC(C)OC(C)OCC(=O)O |
| InChI | InChI=1S/C10H21NO6/c1-7(14-5-4-11)16-9(3)17-8(2)15-6-10(12)13/h7-9H,4-6,11H2,1-3H3,(H,12,13) |
| InChIKey | KHOJCBYVAHEERZ-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.28 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|