C8H17NO6 — CID 172772523
acetic acid;2-[2-(2-aminoethoxy)ethoxy]acetic acid (PubChem CID 172772523) has the molecular formula C8H17NO6 and a molecular weight of 223.22 g/mol. Its IUPAC name is acetic acid;2-[2-(2-aminoethoxy)ethoxy]acetic acid.
| Compound Name | acetic acid;2-[2-(2-aminoethoxy)ethoxy]acetic acid |
|---|---|
| PubChem CID | 172772523 |
| Molecular Formula | C8H17NO6 |
| Molecular Weight | 223.22 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | acetic acid;2-[2-(2-aminoethoxy)ethoxy]acetic acid |
| SMILES | CC(=O)O.NCCOCCOCC(=O)O |
| InChI | InChI=1S/C6H13NO4.C2H4O2/c7-1-2-10-3-4-11-5-6(8)9;1-2(3)4/h1-5,7H2,(H,8,9);1H3,(H,3,4) |
| InChIKey | NDQPSCZVFNWULQ-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.22 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|