C10H20NO6- — CID 23086951
2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetate (PubChem CID 23086951) has the molecular formula C10H20NO6- and a molecular weight of 250.27 g/mol. Its IUPAC name is 2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | 2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 23086951 |
| Molecular Formula | C10H20NO6- |
| Molecular Weight | 250.27 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]acetate |
| SMILES | NCCOCCOCCOCCOCC(=O)[O-] |
| InChI | InChI=1S/C10H21NO6/c11-1-2-14-3-4-15-5-6-16-7-8-17-9-10(12)13/h1-9,11H2,(H,12,13)/p-1 |
| InChIKey | NPRAKTLKDKKZAV-UHFFFAOYSA-M |
| XLogP | -2.24 |
| TPSA | 103.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.27 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|