C14H27NaO9 — CID 165437635
sodium 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate (PubChem CID 165437635) has the molecular formula C14H27NaO9 and a molecular weight of 362.35 g/mol. Its IUPAC name is sodium 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate.
| Compound Name | sodium 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 165437635 |
| Molecular Formula | C14H27NaO9 |
| Molecular Weight | 362.35 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | sodium 2-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetate |
| SMILES | O=C([O-])COCCOCCOCCOCCOCCOCCO.[Na+] |
| InChI | InChI=1S/C14H28O9.Na/c15-1-2-18-3-4-19-5-6-20-7-8-21-9-10-22-11-12-23-13-14(16)17;/h15H,1-13H2,(H,16,17);/q;+1/p-1 |
| InChIKey | HGHJIPZHUYNLSM-UHFFFAOYSA-M |
| XLogP | -5.17 |
| TPSA | 115.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.35 |
| LogP ≤ 5 | -5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|