C20H39NaO4 — CID 23688956
sodium 2-(2-hexadecoxyethoxy)acetate (PubChem CID 23688956) has the molecular formula C20H39NaO4 and a molecular weight of 366.52 g/mol. Its IUPAC name is sodium 2-(2-hexadecoxyethoxy)acetate.
| Compound Name | sodium 2-(2-hexadecoxyethoxy)acetate |
|---|---|
| PubChem CID | 23688956 |
| Molecular Formula | C20H39NaO4 |
| Molecular Weight | 366.52 g/mol |
| Exact Mass | 366.27 |
| IUPAC Name | sodium 2-(2-hexadecoxyethoxy)acetate |
| SMILES | CCCCCCCCCCCCCCCCOCCOCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C20H40O4.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-23-17-18-24-19-20(21)22;/h2-19H2,1H3,(H,21,22);/q;+1/p-1 |
| InChIKey | DWPSYGLTBCBSMP-UHFFFAOYSA-M |
| XLogP | 1.25 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.52 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|