C22H43NaO4 — CID 23688971
sodium 2-(2-octadecoxyethoxy)acetate (PubChem CID 23688971) has the molecular formula C22H43NaO4 and a molecular weight of 394.57 g/mol. Its IUPAC name is sodium 2-(2-octadecoxyethoxy)acetate.
| Compound Name | sodium 2-(2-octadecoxyethoxy)acetate |
|---|---|
| PubChem CID | 23688971 |
| Molecular Formula | C22H43NaO4 |
| Molecular Weight | 394.57 g/mol |
| Exact Mass | 394.31 |
| IUPAC Name | sodium 2-(2-octadecoxyethoxy)acetate |
| SMILES | CCCCCCCCCCCCCCCCCCOCCOCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C22H44O4.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-25-19-20-26-21-22(23)24;/h2-21H2,1H3,(H,23,24);/q;+1/p-1 |
| InChIKey | GRBSWOWRRUUEOA-UHFFFAOYSA-M |
| XLogP | 2.04 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.57 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|